C17H24N4O5 — CID 131850946
(2S)-2-[[(2S)-2-[(2-hydroxybenzoyl)amino]-4-methylpentanoyl]amino]butanediamide (PubChem CID 131850946) has the molecular formula C17H24N4O5 and a molecular weight of 364.40 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2-hydroxybenzoyl)amino]-4-methylpentanoyl]amino]butanediamide.
| Compound Name | (2S)-2-[[(2S)-2-[(2-hydroxybenzoyl)amino]-4-methylpentanoyl]amino]butanediamide |
|---|---|
| PubChem CID | 131850946 |
| Molecular Formula | C17H24N4O5 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2-hydroxybenzoyl)amino]-4-methylpentanoyl]amino]butanediamide |
| SMILES | CC(C)C[C@H](NC(=O)c1ccccc1O)C(=O)N[C@@H](CC(N)=O)C(N)=O |
| InChI | InChI=1S/C17H24N4O5/c1-9(2)7-12(17(26)20-11(15(19)24)8-14(18)23)21-16(25)10-5-3-4-6-13(10)22/h3-6,9,11-12,22H,7-8H2,1-2H3,(H2,18,23)(H2,19,24)(H,20,26)(H,21,25)/t11-,12-/m0/s1 |
| InChIKey | VCLBEUMBIQABLH-RYUDHWBXSA-N |
| XLogP | -0.62 |
| TPSA | 164.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |