C8H12O3 — CID 131851932
2-methyl-1,3-dioxaspiro[4.4]nonan-4-one (PubChem CID 131851932) has the molecular formula C8H12O3 and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-methyl-1,3-dioxaspiro[4.4]nonan-4-one.
| Compound Name | 2-methyl-1,3-dioxaspiro[4.4]nonan-4-one |
|---|---|
| PubChem CID | 131851932 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-methyl-1,3-dioxaspiro[4.4]nonan-4-one |
| SMILES | CC1OC(=O)C2(CCCC2)O1 |
| InChI | InChI=1S/C8H12O3/c1-6-10-7(9)8(11-6)4-2-3-5-8/h6H,2-5H2,1H3 |
| InChIKey | MENSNWNKGMXCMV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |