C9H8O6 — CID 91031833
7-methyl-2,9-dioxaspiro[3.6]decane-1,3,8,10-tetrone (PubChem CID 91031833) has the molecular formula C9H8O6 and a molecular weight of 212.16 g/mol. Its IUPAC name is 7-methyl-2,9-dioxaspiro[3.6]decane-1,3,8,10-tetrone.
| Compound Name | 7-methyl-2,9-dioxaspiro[3.6]decane-1,3,8,10-tetrone |
|---|---|
| PubChem CID | 91031833 |
| Molecular Formula | C9H8O6 |
| Molecular Weight | 212.16 g/mol |
| Exact Mass | 212.03 |
| IUPAC Name | 7-methyl-2,9-dioxaspiro[3.6]decane-1,3,8,10-tetrone |
| SMILES | CC1CCC2(C(=O)OC1=O)C(=O)OC2=O |
| InChI | InChI=1S/C9H8O6/c1-4-2-3-9(6(11)14-5(4)10)7(12)15-8(9)13/h4H,2-3H2,1H3 |
| InChIKey | VDAYQLMNOFAIPE-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|