About benzylsulfanyl(tetramethyl)-λ5-stibane
benzylsulfanyl(tetramethyl)-λ5-stibane (PubChem CID 131852530) has the molecular formula C11H19SSb
and a molecular weight of 305.10 g/mol. Its IUPAC name is benzylsulfanyl(tetramethyl)-λ5-stibane.
Molecular Properties
| Compound Name | benzylsulfanyl(tetramethyl)-λ5-stibane |
| PubChem CID | 131852530 |
| Molecular Formula | C11H19SSb |
| Molecular Weight | 305.10 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | benzylsulfanyl(tetramethyl)-λ5-stibane |
| SMILES | C[Sb](C)(C)(C)SCc1ccccc1 |
| InChI | InChI=1S/C7H8S.4CH3.Sb/c8-6-7-4-2-1-3-5-7;;;;;/h1-5,8H,6H2;4*1H3;/q;;;;;+1/p-1 |
| InChIKey | DJCJKBUWXZYLED-UHFFFAOYSA-M |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.10 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzylsulfanyl(tetramethyl)-λ5-stibane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzylsulfanyl(tetramethyl)-λ5-stibane?
The IUPAC name of benzylsulfanyl(tetramethyl)-λ5-stibane (CID 131852530) is benzylsulfanyl(tetramethyl)-λ5-stibane.
What is the SMILES notation for benzylsulfanyl(tetramethyl)-λ5-stibane?
The canonical SMILES for benzylsulfanyl(tetramethyl)-λ5-stibane is C[Sb](C)(C)(C)SCc1ccccc1.
What is the InChIKey of benzylsulfanyl(tetramethyl)-λ5-stibane?
The InChIKey is DJCJKBUWXZYLED-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8S.4CH3.Sb/c8-6-7-4-2-1-3-5-7;;;;;/h1-5,8H,6H2;4*1H3;/q;;;;;+1/p-1.
What are the key properties of benzylsulfanyl(tetramethyl)-λ5-stibane?
benzylsulfanyl(tetramethyl)-λ5-stibane has a molecular weight of 305.10 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzylsulfanyl(tetramethyl)-λ5-stibane is sourced from PubChem (CID 131852530), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).