C18H19NO3S — CID 131853077
2-(9H-fluoren-9-ylsulfinyl)-N-[(2S)-1-hydroxypropan-2-yl]acetamide (PubChem CID 131853077) has the molecular formula C18H19NO3S and a molecular weight of 329.42 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylsulfinyl)-N-[(2S)-1-hydroxypropan-2-yl]acetamide.
| Compound Name | 2-(9H-fluoren-9-ylsulfinyl)-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
|---|---|
| PubChem CID | 131853077 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 2-(9H-fluoren-9-ylsulfinyl)-N-[(2S)-1-hydroxypropan-2-yl]acetamide |
| SMILES | C[C@@H](CO)NC(=O)CS(=O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C18H19NO3S/c1-12(10-20)19-17(21)11-23(22)18-15-8-4-2-6-13(15)14-7-3-5-9-16(14)18/h2-9,12,18,20H,10-11H2,1H3,(H,19,21)/t12-,23?/m0/s1 |
| InChIKey | RZKLATZSEBVYTE-AKYMPMEGSA-N |
| XLogP | 2.00 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |