C10H10O5 — CID 131856943
(4-formyl-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 131856943) has the molecular formula C10H10O5 and a molecular weight of 210.19 g/mol. Its IUPAC name is (4-formyl-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl) acetate.
| Compound Name | (4-formyl-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl) acetate |
|---|---|
| PubChem CID | 131856943 |
| Molecular Formula | C10H10O5 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (4-formyl-1-methoxy-6-oxocyclohexa-2,4-dien-1-yl) acetate |
| SMILES | COC1(OC(C)=O)C=CC(C=O)=CC1=O |
| InChI | InChI=1S/C10H10O5/c1-7(12)15-10(14-2)4-3-8(6-11)5-9(10)13/h3-6H,1-2H3 |
| InChIKey | NUFATPXLYKVJRC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|