C8H10O4 — CID 130031634
3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 130031634) has the molecular formula C8H10O4 and a molecular weight of 170.16 g/mol. Its IUPAC name is 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 130031634 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C=CC(O)=CC1=O |
| InChI | InChI=1S/C8H10O4/c1-11-8(12-2)4-3-6(9)5-7(8)10/h3-5,9H,1-2H3 |
| InChIKey | STAMLVZHWNVVIF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|