About 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one
3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 130031634) has the molecular formula C8H10O4
and a molecular weight of 170.16 g/mol. Its IUPAC name is 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| PubChem CID | 130031634 |
| Molecular Formula | C8H10O4 |
| Molecular Weight | 170.16 g/mol |
| Exact Mass | 170.06 |
| IUPAC Name | 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1(OC)C=CC(O)=CC1=O |
| InChI | InChI=1S/C8H10O4/c1-11-8(12-2)4-3-6(9)5-7(8)10/h3-5,9H,1-2H3 |
| InChIKey | STAMLVZHWNVVIF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.16 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one?
The IUPAC name of 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one (CID 130031634) is 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one.
What is the SMILES notation for 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one?
The canonical SMILES for 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one is COC1(OC)C=CC(O)=CC1=O.
What is the InChIKey of 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one?
The InChIKey is STAMLVZHWNVVIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4/c1-11-8(12-2)4-3-6(9)5-7(8)10/h3-5,9H,1-2H3.
What are the key properties of 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one?
3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one has a molecular weight of 170.16 g/mol, XLogP of 0.56, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-6,6-dimethoxycyclohexa-2,4-dien-1-one is sourced from PubChem (CID 130031634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).