C14H18O6 — CID 101022056
8'-hydroxy-4',4'-dimethoxyspiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-naphthalene]-1'-one (PubChem CID 101022056) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 8'-hydroxy-4',4'-dimethoxyspiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-naphthalene]-1'-one.
| Compound Name | 8'-hydroxy-4',4'-dimethoxyspiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-naphthalene]-1'-one |
|---|---|
| PubChem CID | 101022056 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 8'-hydroxy-4',4'-dimethoxyspiro[1,3-dioxolane-2,6'-7,8-dihydro-5H-naphthalene]-1'-one |
| SMILES | COC1(OC)C=CC(=O)C2=C1CC1(CC2O)OCCO1 |
| InChI | InChI=1S/C14H18O6/c1-17-14(18-2)4-3-10(15)12-9(14)7-13(8-11(12)16)19-5-6-20-13/h3-4,11,16H,5-8H2,1-2H3 |
| InChIKey | ZQKXTOBIVOECHI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|