C12H20O5 — CID 132513330
8-(2,2-dimethoxyethyl)-1,4-dioxaspiro[4.5]dec-8-en-7-ol (PubChem CID 132513330) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is 8-(2,2-dimethoxyethyl)-1,4-dioxaspiro[4.5]dec-8-en-7-ol.
| Compound Name | 8-(2,2-dimethoxyethyl)-1,4-dioxaspiro[4.5]dec-8-en-7-ol |
|---|---|
| PubChem CID | 132513330 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 8-(2,2-dimethoxyethyl)-1,4-dioxaspiro[4.5]dec-8-en-7-ol |
| SMILES | COC(CC1=CCC2(CC1O)OCCO2)OC |
| InChI | InChI=1S/C12H20O5/c1-14-11(15-2)7-9-3-4-12(8-10(9)13)16-5-6-17-12/h3,10-11,13H,4-8H2,1-2H3 |
| InChIKey | UJBHNUXQBSUMTB-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|