C11H18O4 — CID 56654609
(1R,4S)-2-[2-(1,3-dioxolan-2-yl)ethyl]cyclohex-2-ene-1,4-diol (PubChem CID 56654609) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (1R,4S)-2-[2-(1,3-dioxolan-2-yl)ethyl]cyclohex-2-ene-1,4-diol.
| Compound Name | (1R,4S)-2-[2-(1,3-dioxolan-2-yl)ethyl]cyclohex-2-ene-1,4-diol |
|---|---|
| PubChem CID | 56654609 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (1R,4S)-2-[2-(1,3-dioxolan-2-yl)ethyl]cyclohex-2-ene-1,4-diol |
| SMILES | O[C@@H]1C=C(CCC2OCCO2)[C@H](O)CC1 |
| InChI | InChI=1S/C11H18O4/c12-9-2-3-10(13)8(7-9)1-4-11-14-5-6-15-11/h7,9-13H,1-6H2/t9-,10+/m0/s1 |
| InChIKey | JGLRVRFBAVRXFN-VHSXEESVSA-N |
| XLogP | 0.58 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|