C19H20N4O4 — CID 131857520
(2R,3R,4R,5R)-2-(4-amino-2-phenyliminoquinazolin-1-yl)oxane-3,4,5-triol (PubChem CID 131857520) has the molecular formula C19H20N4O4 and a molecular weight of 368.39 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-(4-amino-2-phenyliminoquinazolin-1-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R)-2-(4-amino-2-phenyliminoquinazolin-1-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 131857520 |
| Molecular Formula | C19H20N4O4 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.15 |
| IUPAC Name | (2R,3R,4R,5R)-2-(4-amino-2-phenyliminoquinazolin-1-yl)oxane-3,4,5-triol |
| SMILES | Nc1n/c(=N\c2ccccc2)n([C@@H]2OC[C@@H](O)[C@@H](O)[C@H]2O)c2ccccc12 |
| InChI | InChI=1S/C19H20N4O4/c20-17-12-8-4-5-9-13(12)23(18-16(26)15(25)14(24)10-27-18)19(22-17)21-11-6-2-1-3-7-11/h1-9,14-16,18,24-26H,10H2,(H2,20,21,22)/t14-,15-,16-,18-/m1/s1 |
| InChIKey | ZFZXSZDXZRUBRT-YFHUEUNASA-N |
| XLogP | 0.46 |
| TPSA | 126.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |