C8H12N4O2 — CID 131858088
1-(cyclopropylmethyl)-6-hydrazinylidene-1,3-diazinane-2,4-dione (PubChem CID 131858088) has the molecular formula C8H12N4O2 and a molecular weight of 196.21 g/mol. Its IUPAC name is 1-(cyclopropylmethyl)-6-hydrazinylidene-1,3-diazinane-2,4-dione.
| Compound Name | 1-(cyclopropylmethyl)-6-hydrazinylidene-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 131858088 |
| Molecular Formula | C8H12N4O2 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | 1-(cyclopropylmethyl)-6-hydrazinylidene-1,3-diazinane-2,4-dione |
| SMILES | NN=C1CC(=O)NC(=O)N1CC1CC1 |
| InChI | InChI=1S/C8H12N4O2/c9-11-6-3-7(13)10-8(14)12(6)4-5-1-2-5/h5H,1-4,9H2,(H,10,13,14) |
| InChIKey | KBFKYDGIIQVUEV-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|