C11H20N4O2 — CID 146012962
(6Z)-1-butyl-6-hydrazinylidene-3-propyl-1,3-diazinane-2,4-dione (PubChem CID 146012962) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is (6Z)-1-butyl-6-hydrazinylidene-3-propyl-1,3-diazinane-2,4-dione.
| Compound Name | (6Z)-1-butyl-6-hydrazinylidene-3-propyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 146012962 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | (6Z)-1-butyl-6-hydrazinylidene-3-propyl-1,3-diazinane-2,4-dione |
| SMILES | CCCCN1C(=O)N(CCC)C(=O)C/C1=N/N |
| InChI | InChI=1S/C11H20N4O2/c1-3-5-7-14-9(13-12)8-10(16)15(6-4-2)11(14)17/h3-8,12H2,1-2H3/b13-9- |
| InChIKey | FFGBJEBWQXDNCJ-LCYFTJDESA-N |
| XLogP | 1.12 |
| TPSA | 79.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|