C5H8N4O2 — CID 137272891
(6E)-6-hydrazinylidene-3-methyl-1,3-diazinane-2,4-dione (PubChem CID 137272891) has the molecular formula C5H8N4O2 and a molecular weight of 156.15 g/mol. Its IUPAC name is (6E)-6-hydrazinylidene-3-methyl-1,3-diazinane-2,4-dione.
| Compound Name | (6E)-6-hydrazinylidene-3-methyl-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 137272891 |
| Molecular Formula | C5H8N4O2 |
| Molecular Weight | 156.15 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | (6E)-6-hydrazinylidene-3-methyl-1,3-diazinane-2,4-dione |
| SMILES | CN1C(=O)C/C(=N\N)NC1=O |
| InChI | InChI=1S/C5H8N4O2/c1-9-4(10)2-3(8-6)7-5(9)11/h2,6H2,1H3,(H,7,8,11) |
| InChIKey | NJIBJIDGPMNHLY-UHFFFAOYSA-N |
| XLogP | -1.17 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.15 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|