C8H8O2 — CID 131859522
(3aR,6aR)-3-methylidene-4,6a-dihydro-3aH-cyclopenta[b]furan-2-one (PubChem CID 131859522) has the molecular formula C8H8O2 and a molecular weight of 136.15 g/mol. Its IUPAC name is (3aR,6aR)-3-methylidene-4,6a-dihydro-3aH-cyclopenta[b]furan-2-one.
| Compound Name | (3aR,6aR)-3-methylidene-4,6a-dihydro-3aH-cyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 131859522 |
| Molecular Formula | C8H8O2 |
| Molecular Weight | 136.15 g/mol |
| Exact Mass | 136.05 |
| IUPAC Name | (3aR,6aR)-3-methylidene-4,6a-dihydro-3aH-cyclopenta[b]furan-2-one |
| SMILES | C=C1C(=O)O[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C8H8O2/c1-5-6-3-2-4-7(6)10-8(5)9/h2,4,6-7H,1,3H2/t6-,7-/m1/s1 |
| InChIKey | YJZSCBNXFHQEHK-RNFRBKRXSA-N |
| XLogP | 1.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.15 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|