About ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate
ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate (PubChem CID 131860327) has the molecular formula C9H17NO4
and a molecular weight of 203.24 g/mol. Its IUPAC name is ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate |
| PubChem CID | 131860327 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@@H](OCC)ON1C |
| InChI | InChI=1S/C9H17NO4/c1-4-12-8-6-7(10(3)14-8)9(11)13-5-2/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1 |
| InChIKey | DLIRHJKYVZPCLU-SFYZADRCSA-N |
| XLogP | 0.55 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate?
The IUPAC name of ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate (CID 131860327) is ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate.
What is the SMILES notation for ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate?
The canonical SMILES for ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate is CCOC(=O)[C@H]1C[C@@H](OCC)ON1C.
What is the InChIKey of ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate?
The InChIKey is DLIRHJKYVZPCLU-SFYZADRCSA-N. The full InChI is InChI=1S/C9H17NO4/c1-4-12-8-6-7(10(3)14-8)9(11)13-5-2/h7-8H,4-6H2,1-3H3/t7-,8+/m1/s1.
What are the key properties of ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate?
ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate has a molecular weight of 203.24 g/mol, XLogP of 0.55, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R,5S)-5-ethoxy-2-methyl-1,2-oxazolidine-3-carboxylate is sourced from PubChem (CID 131860327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).