C15H13ClO4 — CID 131862181
8-acetyl-6-(2-chloroprop-2-enyl)-7-hydroxy-4-methylchromen-2-one (PubChem CID 131862181) has the molecular formula C15H13ClO4 and a molecular weight of 292.72 g/mol. Its IUPAC name is 8-acetyl-6-(2-chloroprop-2-enyl)-7-hydroxy-4-methylchromen-2-one.
| Compound Name | 8-acetyl-6-(2-chloroprop-2-enyl)-7-hydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 131862181 |
| Molecular Formula | C15H13ClO4 |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 8-acetyl-6-(2-chloroprop-2-enyl)-7-hydroxy-4-methylchromen-2-one |
| SMILES | C=C(Cl)Cc1cc2c(C)cc(=O)oc2c(C(C)=O)c1O |
| InChI | InChI=1S/C15H13ClO4/c1-7-4-12(18)20-15-11(7)6-10(5-8(2)16)14(19)13(15)9(3)17/h4,6,19H,2,5H2,1,3H3 |
| InChIKey | HFEZWGSAWTXMGP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|