C14H11ClO4 — CID 131862178
6-(2-chloroprop-2-enyl)-7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde (PubChem CID 131862178) has the molecular formula C14H11ClO4 and a molecular weight of 278.69 g/mol. Its IUPAC name is 6-(2-chloroprop-2-enyl)-7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde.
| Compound Name | 6-(2-chloroprop-2-enyl)-7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde |
|---|---|
| PubChem CID | 131862178 |
| Molecular Formula | C14H11ClO4 |
| Molecular Weight | 278.69 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | 6-(2-chloroprop-2-enyl)-7-hydroxy-4-methyl-2-oxochromene-8-carbaldehyde |
| SMILES | C=C(Cl)Cc1cc2c(C)cc(=O)oc2c(C=O)c1O |
| InChI | InChI=1S/C14H11ClO4/c1-7-3-12(17)19-14-10(7)5-9(4-8(2)15)13(18)11(14)6-16/h3,5-6,18H,2,4H2,1H3 |
| InChIKey | VKPZDQQCENKMOL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.69 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|