C14H18O2S — CID 131864004
(5S,6S)-5-benzyl-6-propan-2-yl-1,3-oxathian-4-one (PubChem CID 131864004) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is (5S,6S)-5-benzyl-6-propan-2-yl-1,3-oxathian-4-one.
| Compound Name | (5S,6S)-5-benzyl-6-propan-2-yl-1,3-oxathian-4-one |
|---|---|
| PubChem CID | 131864004 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (5S,6S)-5-benzyl-6-propan-2-yl-1,3-oxathian-4-one |
| SMILES | CC(C)[C@@H]1OCSC(=O)[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C14H18O2S/c1-10(2)13-12(14(15)17-9-16-13)8-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | UDHGXKYORDBILX-STQMWFEESA-N |
| XLogP | 3.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|