C22H20N2O2S2 — CID 131864133
(2R,3S)-2,3-bis(2-oxopropyl)-2,3-bis(phenylsulfanyl)butanedinitrile (PubChem CID 131864133) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is (2R,3S)-2,3-bis(2-oxopropyl)-2,3-bis(phenylsulfanyl)butanedinitrile.
| Compound Name | (2R,3S)-2,3-bis(2-oxopropyl)-2,3-bis(phenylsulfanyl)butanedinitrile |
|---|---|
| PubChem CID | 131864133 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | (2R,3S)-2,3-bis(2-oxopropyl)-2,3-bis(phenylsulfanyl)butanedinitrile |
| SMILES | CC(=O)C[C@@](C#N)(Sc1ccccc1)[C@](C#N)(CC(C)=O)Sc1ccccc1 |
| InChI | InChI=1S/C22H20N2O2S2/c1-17(25)13-21(15-23,27-19-9-5-3-6-10-19)22(16-24,14-18(2)26)28-20-11-7-4-8-12-20/h3-12H,13-14H2,1-2H3/t21-,22+ |
| InChIKey | BEMQZJOYTIEZIG-SZPZYZBQSA-N |
| XLogP | 5.05 |
| TPSA | 81.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |