C14H19NO7 — CID 131864914
[[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino] 2-phenylacetate (PubChem CID 131864914) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is [[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino] 2-phenylacetate.
| Compound Name | [[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino] 2-phenylacetate |
|---|---|
| PubChem CID | 131864914 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | [[(3R,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino] 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)ON[C@H]1C(O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C14H19NO7/c16-7-9-12(18)13(19)11(14(20)21-9)15-22-10(17)6-8-4-2-1-3-5-8/h1-5,9,11-16,18-20H,6-7H2/t9-,11-,12-,13-,14?/m1/s1 |
| InChIKey | KBVAZMOWOVUDOC-NKLQQJLKSA-N |
| XLogP | -1.92 |
| TPSA | 128.48 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|