C16H21N2O6+ — CID 171417908
methylidyne-[[3-[2-oxo-2-[[(3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]ethyl]phenyl]methyl]azanium (PubChem CID 171417908) has the molecular formula C16H21N2O6+ and a molecular weight of 337.35 g/mol. Its IUPAC name is methylidyne-[[3-[2-oxo-2-[[(3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]ethyl]phenyl]methyl]azanium.
| Compound Name | methylidyne-[[3-[2-oxo-2-[[(3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]ethyl]phenyl]methyl]azanium |
|---|---|
| PubChem CID | 171417908 |
| Molecular Formula | C16H21N2O6+ |
| Molecular Weight | 337.35 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | methylidyne-[[3-[2-oxo-2-[[(3S,4R,5S,6R)-2,4,5-trihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]ethyl]phenyl]methyl]azanium |
| SMILES | C#[N+]Cc1cccc(CC(=O)N[C@@H]2C(O)O[C@H](CO)[C@@H](O)[C@@H]2O)c1 |
| InChI | InChI=1S/C16H20N2O6/c1-17-7-10-4-2-3-9(5-10)6-12(20)18-13-15(22)14(21)11(8-19)24-16(13)23/h1-5,11,13-16,19,21-23H,6-8H2/p+1/t11-,13+,14-,15-,16?/m1/s1 |
| InChIKey | SOANSQBSQBORDD-LIADDWGISA-O |
| XLogP | -1.39 |
| TPSA | 123.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.35 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |