About ethyl 2-benzamidooxypropanoate
ethyl 2-benzamidooxypropanoate (PubChem CID 131865576) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is ethyl 2-benzamidooxypropanoate.
Molecular Properties
| Compound Name | ethyl 2-benzamidooxypropanoate |
| PubChem CID | 131865576 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | ethyl 2-benzamidooxypropanoate |
| SMILES | CCOC(=O)C(C)ONC(=O)c1ccccc1 |
| InChI | InChI=1S/C12H15NO4/c1-3-16-12(15)9(2)17-13-11(14)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H,13,14) |
| InChIKey | YEBLWOWQIASOGQ-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-benzamidooxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-benzamidooxypropanoate?
The IUPAC name of ethyl 2-benzamidooxypropanoate (CID 131865576) is ethyl 2-benzamidooxypropanoate.
What is the SMILES notation for ethyl 2-benzamidooxypropanoate?
The canonical SMILES for ethyl 2-benzamidooxypropanoate is CCOC(=O)C(C)ONC(=O)c1ccccc1.
What is the InChIKey of ethyl 2-benzamidooxypropanoate?
The InChIKey is YEBLWOWQIASOGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-3-16-12(15)9(2)17-13-11(14)10-7-5-4-6-8-10/h4-9H,3H2,1-2H3,(H,13,14).
What are the key properties of ethyl 2-benzamidooxypropanoate?
ethyl 2-benzamidooxypropanoate has a molecular weight of 237.25 g/mol, XLogP of 1.30, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-benzamidooxypropanoate is sourced from PubChem (CID 131865576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).