C12H16BrF2O4P — CID 131866091
[1-(3-bromophenyl)-2,2-difluoroethyl] diethyl phosphate (PubChem CID 131866091) has the molecular formula C12H16BrF2O4P and a molecular weight of 373.13 g/mol. Its IUPAC name is [1-(3-bromophenyl)-2,2-difluoroethyl] diethyl phosphate.
| Compound Name | [1-(3-bromophenyl)-2,2-difluoroethyl] diethyl phosphate |
|---|---|
| PubChem CID | 131866091 |
| Molecular Formula | C12H16BrF2O4P |
| Molecular Weight | 373.13 g/mol |
| Exact Mass | 371.99 |
| IUPAC Name | [1-(3-bromophenyl)-2,2-difluoroethyl] diethyl phosphate |
| SMILES | CCOP(=O)(OCC)OC(c1cccc(Br)c1)C(F)F |
| InChI | InChI=1S/C12H16BrF2O4P/c1-3-17-20(16,18-4-2)19-11(12(14)15)9-6-5-7-10(13)8-9/h5-8,11-12H,3-4H2,1-2H3 |
| InChIKey | PTKWLIFTACCPRZ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.13 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|