C12H14O3 — CID 131866409
1-oxaspiro[5.7]trideca-3,9-diene-2,5-dione (PubChem CID 131866409) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-oxaspiro[5.7]trideca-3,9-diene-2,5-dione.
| Compound Name | 1-oxaspiro[5.7]trideca-3,9-diene-2,5-dione |
|---|---|
| PubChem CID | 131866409 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-oxaspiro[5.7]trideca-3,9-diene-2,5-dione |
| SMILES | O=C1C=CC(=O)C2(CCC=CCCC2)O1 |
| InChI | InChI=1S/C12H14O3/c13-10-6-7-11(14)15-12(10)8-4-2-1-3-5-9-12/h1-2,6-7H,3-5,8-9H2 |
| InChIKey | KPHWKXHDXAZDIH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|