C13H14BrNO4S — CID 131867508
[2-bromo-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-5-yl]methanol (PubChem CID 131867508) has the molecular formula C13H14BrNO4S and a molecular weight of 360.23 g/mol. Its IUPAC name is [2-bromo-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-5-yl]methanol.
| Compound Name | [2-bromo-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 131867508 |
| Molecular Formula | C13H14BrNO4S |
| Molecular Weight | 360.23 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | [2-bromo-4-(3,4,5-trimethoxyphenyl)-1,3-thiazol-5-yl]methanol |
| SMILES | COc1cc(-c2nc(Br)sc2CO)cc(OC)c1OC |
| InChI | InChI=1S/C13H14BrNO4S/c1-17-8-4-7(5-9(18-2)12(8)19-3)11-10(6-16)20-13(14)15-11/h4-5,16H,6H2,1-3H3 |
| InChIKey | KSRWHWHIVQWHEA-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 60.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.23 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |