C19H21N — CID 13186802
2-(8-tricyclo[5.2.1.02,6]decanyl)quinoline (PubChem CID 13186802) has the molecular formula C19H21N and a molecular weight of 263.38 g/mol. Its IUPAC name is 2-(8-tricyclo[5.2.1.02,6]decanyl)quinoline.
| Compound Name | 2-(8-tricyclo[5.2.1.02,6]decanyl)quinoline |
|---|---|
| PubChem CID | 13186802 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 2-(8-tricyclo[5.2.1.02,6]decanyl)quinoline |
| SMILES | c1ccc2nc(C3CC4CC3C3CCCC43)ccc2c1 |
| InChI | InChI=1S/C19H21N/c1-2-7-18-12(4-1)8-9-19(20-18)17-11-13-10-16(17)15-6-3-5-14(13)15/h1-2,4,7-9,13-17H,3,5-6,10-11H2 |
| InChIKey | UQSWYCDTAHDTMZ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |