C19H25N — CID 122214686
2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]quinoline (PubChem CID 122214686) has the molecular formula C19H25N and a molecular weight of 267.42 g/mol. Its IUPAC name is 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]quinoline.
| Compound Name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]quinoline |
|---|---|
| PubChem CID | 122214686 |
| Molecular Formula | C19H25N |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | 2-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]quinoline |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1c1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H25N/c1-13(2)16-10-8-14(3)12-17(16)19-11-9-15-6-4-5-7-18(15)20-19/h4-7,9,11,13-14,16-17H,8,10,12H2,1-3H3/t14-,16+,17-/m1/s1 |
| InChIKey | DROHYGMDPWAUNI-HYVNUMGLSA-N |
| XLogP | 5.41 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |