C19H25- — CID 134856636
1-[(1R,5S)-5-methyl-2-propan-2-ylcyclohexyl]inden-1-ide (PubChem CID 134856636) has the molecular formula C19H25- and a molecular weight of 253.41 g/mol. Its IUPAC name is 1-[(1R,5S)-5-methyl-2-propan-2-ylcyclohexyl]inden-1-ide.
| Compound Name | 1-[(1R,5S)-5-methyl-2-propan-2-ylcyclohexyl]inden-1-ide |
|---|---|
| PubChem CID | 134856636 |
| Molecular Formula | C19H25- |
| Molecular Weight | 253.41 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 1-[(1R,5S)-5-methyl-2-propan-2-ylcyclohexyl]inden-1-ide |
| SMILES | CC(C)C1CC[C@H](C)C[C@@H]1[c-]1ccc2ccccc21 |
| InChI | InChI=1S/C19H25/c1-13(2)16-10-8-14(3)12-19(16)18-11-9-15-6-4-5-7-17(15)18/h4-7,9,11,13-14,16,19H,8,10,12H2,1-3H3/q-1/t14-,16?,19-/m0/s1 |
| InChIKey | IDKAGGVNIFARMB-SXUUOERCSA-N |
| XLogP | 5.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.41 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|