C22H27NO4 — CID 3672460
[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 3672460) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 3672460 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)COC(=O)c2ccc3ccccc3n2)C1 |
| InChI | InChI=1S/C22H27NO4/c1-14(2)17-10-8-15(3)12-20(17)27-21(24)13-26-22(25)19-11-9-16-6-4-5-7-18(16)23-19/h4-7,9,11,14-15,17,20H,8,10,12-13H2,1-3H3 |
| InChIKey | OBQRMBQZEQPVAY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |