C18H26O4S — CID 3519179
[2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 3-methylthiophene-2-carboxylate (PubChem CID 3519179) has the molecular formula C18H26O4S and a molecular weight of 338.47 g/mol. Its IUPAC name is [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 3519179 |
| Molecular Formula | C18H26O4S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)oxy-2-oxoethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)OCC(=O)OC1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C18H26O4S/c1-11(2)14-6-5-12(3)9-15(14)22-16(19)10-21-18(20)17-13(4)7-8-23-17/h7-8,11-12,14-15H,5-6,9-10H2,1-4H3 |
| InChIKey | AIEJHOKPOVBUOQ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |