C42H52N4O2 — CID 172636273
2-N,6-N-bis[3-(5-methyl-2-propan-2-ylcyclohexyl)-2-pyridinyl]naphthalene-2,6-dicarboxamide (PubChem CID 172636273) has the molecular formula C42H52N4O2 and a molecular weight of 644.90 g/mol. Its IUPAC name is 2-N,6-N-bis[3-(5-methyl-2-propan-2-ylcyclohexyl)-2-pyridinyl]naphthalene-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[3-(5-methyl-2-propan-2-ylcyclohexyl)-2-pyridinyl]naphthalene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 172636273 |
| Molecular Formula | C42H52N4O2 |
| Molecular Weight | 644.90 g/mol |
| Exact Mass | 644.41 |
| IUPAC Name | 2-N,6-N-bis[3-(5-methyl-2-propan-2-ylcyclohexyl)-2-pyridinyl]naphthalene-2,6-dicarboxamide |
| SMILES | CC1CCC(C(C)C)C(c2cccnc2NC(=O)c2ccc3cc(C(=O)Nc4ncccc4C4CC(C)CCC4C(C)C)ccc3c2)C1 |
| InChI | InChI=1S/C42H52N4O2/c1-25(2)33-17-11-27(5)21-37(33)35-9-7-19-43-39(35)45-41(47)31-15-13-30-24-32(16-14-29(30)23-31)42(48)46-40-36(10-8-20-44-40)38-22-28(6)12-18-34(38)26(3)4/h7-10,13-16,19-20,23-28,33-34,37-38H,11-12,17-18,21-22H2,1-6H3,(H,43,45,47)(H,44,46,48) |
| InChIKey | SGNIBCMCBCHWKD-UHFFFAOYSA-N |
| XLogP | 10.49 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.90 |
| LogP ≤ 5 | 10.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |