C19H26O2 — CID 67635828
[2-(5-methyl-2-propan-2-ylcyclohexyl)phenyl] prop-2-enoate (PubChem CID 67635828) has the molecular formula C19H26O2 and a molecular weight of 286.42 g/mol. Its IUPAC name is [2-(5-methyl-2-propan-2-ylcyclohexyl)phenyl] prop-2-enoate.
| Compound Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)phenyl] prop-2-enoate |
|---|---|
| PubChem CID | 67635828 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.42 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | [2-(5-methyl-2-propan-2-ylcyclohexyl)phenyl] prop-2-enoate |
| SMILES | C=CC(=O)Oc1ccccc1C1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C19H26O2/c1-5-19(20)21-18-9-7-6-8-16(18)17-12-14(4)10-11-15(17)13(2)3/h5-9,13-15,17H,1,10-12H2,2-4H3 |
| InChIKey | UVXTZKDEOIANMS-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.42 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|