C18H28O3P+ — CID 54332940
[2-methoxy-3-[(1S)-5-methyl-2-propan-2-ylcyclohexyl]phenoxy]-methyl-oxophosphanium (PubChem CID 54332940) has the molecular formula C18H28O3P+ and a molecular weight of 323.39 g/mol. Its IUPAC name is [2-methoxy-3-[(1S)-5-methyl-2-propan-2-ylcyclohexyl]phenoxy]-methyl-oxophosphanium.
| Compound Name | [2-methoxy-3-[(1S)-5-methyl-2-propan-2-ylcyclohexyl]phenoxy]-methyl-oxophosphanium |
|---|---|
| PubChem CID | 54332940 |
| Molecular Formula | C18H28O3P+ |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | [2-methoxy-3-[(1S)-5-methyl-2-propan-2-ylcyclohexyl]phenoxy]-methyl-oxophosphanium |
| SMILES | COc1c(O[P+](C)=O)cccc1[C@H]1CC(C)CCC1C(C)C |
| InChI | InChI=1S/C18H28O3P/c1-12(2)14-10-9-13(3)11-16(14)15-7-6-8-17(18(15)20-4)21-22(5)19/h6-8,12-14,16H,9-11H2,1-5H3/q+1/t13?,14?,16-/m0/s1 |
| InChIKey | OOJFDVUXZCVURV-XUJLQICISA-N |
| XLogP | 5.62 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|