C16H12ClN3 — CID 131870624
6-(chloromethyl)-2,3-dipyridin-3-ylpyridine (PubChem CID 131870624) has the molecular formula C16H12ClN3 and a molecular weight of 281.75 g/mol. Its IUPAC name is 6-(chloromethyl)-2,3-dipyridin-3-ylpyridine.
| Compound Name | 6-(chloromethyl)-2,3-dipyridin-3-ylpyridine |
|---|---|
| PubChem CID | 131870624 |
| Molecular Formula | C16H12ClN3 |
| Molecular Weight | 281.75 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 6-(chloromethyl)-2,3-dipyridin-3-ylpyridine |
| SMILES | ClCc1ccc(-c2cccnc2)c(-c2cccnc2)n1 |
| InChI | InChI=1S/C16H12ClN3/c17-9-14-5-6-15(12-3-1-7-18-10-12)16(20-14)13-4-2-8-19-11-13/h1-8,10-11H,9H2 |
| InChIKey | YQJIENSTCYPYSC-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.75 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|