C21H26Cl2N6O — CID 131875120
1,3-bis[4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]urea;dihydrochloride (PubChem CID 131875120) has the molecular formula C21H26Cl2N6O and a molecular weight of 449.39 g/mol. Its IUPAC name is 1,3-bis[4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]urea;dihydrochloride.
| Compound Name | 1,3-bis[4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]urea;dihydrochloride |
|---|---|
| PubChem CID | 131875120 |
| Molecular Formula | C21H26Cl2N6O |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 1,3-bis[4-(5-methyl-4,5-dihydro-1H-imidazol-2-yl)phenyl]urea;dihydrochloride |
| SMILES | CC1CN=C(c2ccc(NC(=O)Nc3ccc(C4=NCC(C)N4)cc3)cc2)N1.Cl.Cl |
| InChI | InChI=1S/C21H24N6O.2ClH/c1-13-11-22-19(24-13)15-3-7-17(8-4-15)26-21(28)27-18-9-5-16(6-10-18)20-23-12-14(2)25-20;;/h3-10,13-14H,11-12H2,1-2H3,(H,22,24)(H,23,25)(H2,26,27,28);2*1H |
| InChIKey | QJHRMNYZZAOUJY-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 89.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |