C12H19N5O2 — CID 131881447
2-(azepan-1-yl)-N,6-dimethyl-5-nitropyrimidin-4-amine (PubChem CID 131881447) has the molecular formula C12H19N5O2 and a molecular weight of 265.32 g/mol. Its IUPAC name is 2-(azepan-1-yl)-N,6-dimethyl-5-nitropyrimidin-4-amine.
| Compound Name | 2-(azepan-1-yl)-N,6-dimethyl-5-nitropyrimidin-4-amine |
|---|---|
| PubChem CID | 131881447 |
| Molecular Formula | C12H19N5O2 |
| Molecular Weight | 265.32 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | 2-(azepan-1-yl)-N,6-dimethyl-5-nitropyrimidin-4-amine |
| SMILES | CNc1nc(N2CCCCCC2)nc(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H19N5O2/c1-9-10(17(18)19)11(13-2)15-12(14-9)16-7-5-3-4-6-8-16/h3-8H2,1-2H3,(H,13,14,15) |
| InChIKey | KSGIZBVDVFQGII-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.32 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|