C11H11Cl2N3O2 — CID 131883651
1-[(2,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine (PubChem CID 131883651) has the molecular formula C11H11Cl2N3O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 1-[(2,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine.
| Compound Name | 1-[(2,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine |
|---|---|
| PubChem CID | 131883651 |
| Molecular Formula | C11H11Cl2N3O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.02 |
| IUPAC Name | 1-[(2,4-dichlorophenyl)methyl]-2-(nitromethylidene)imidazolidine |
| SMILES | O=[N+]([O-])C=C1NCCN1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H11Cl2N3O2/c12-9-2-1-8(10(13)5-9)6-15-4-3-14-11(15)7-16(17)18/h1-2,5,7,14H,3-4,6H2 |
| InChIKey | CDFQDOBGPMLLAA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|