C18H32Cl2N2O2 — CID 131884300
3-amino-2-[2-[di(propan-2-yl)amino]ethoxy]-1-phenylbutan-1-one;dihydrochloride (PubChem CID 131884300) has the molecular formula C18H32Cl2N2O2 and a molecular weight of 379.37 g/mol. Its IUPAC name is 3-amino-2-[2-[di(propan-2-yl)amino]ethoxy]-1-phenylbutan-1-one;dihydrochloride.
| Compound Name | 3-amino-2-[2-[di(propan-2-yl)amino]ethoxy]-1-phenylbutan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 131884300 |
| Molecular Formula | C18H32Cl2N2O2 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 3-amino-2-[2-[di(propan-2-yl)amino]ethoxy]-1-phenylbutan-1-one;dihydrochloride |
| SMILES | CC(N)C(OCCN(C(C)C)C(C)C)C(=O)c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C18H30N2O2.2ClH/c1-13(2)20(14(3)4)11-12-22-18(15(5)19)17(21)16-9-7-6-8-10-16;;/h6-10,13-15,18H,11-12,19H2,1-5H3;2*1H |
| InChIKey | RBYCPEVQYUUPCC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |