C18H30ClNO2 — CID 26733
2-(1-oxo-1-phenylbutan-2-yl)oxyethyl-di(propan-2-yl)azanium chloride (PubChem CID 26733) has the molecular formula C18H30ClNO2 and a molecular weight of 327.90 g/mol. Its IUPAC name is 2-(1-oxo-1-phenylbutan-2-yl)oxyethyl-di(propan-2-yl)azanium chloride.
| Compound Name | 2-(1-oxo-1-phenylbutan-2-yl)oxyethyl-di(propan-2-yl)azanium chloride |
|---|---|
| PubChem CID | 26733 |
| Molecular Formula | C18H30ClNO2 |
| Molecular Weight | 327.90 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | 2-(1-oxo-1-phenylbutan-2-yl)oxyethyl-di(propan-2-yl)azanium chloride |
| SMILES | CCC(OCC[NH+](C(C)C)C(C)C)C(=O)c1ccccc1.[Cl-] |
| InChI | InChI=1S/C18H29NO2.ClH/c1-6-17(18(20)16-10-8-7-9-11-16)21-13-12-19(14(2)3)15(4)5;/h7-11,14-15,17H,6,12-13H2,1-5H3;1H |
| InChIKey | PDTNJULAMCAUDW-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.90 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |