C12H18NNaO8Sb — CID 131884369
CID 131884369 (PubChem CID 131884369) has the molecular formula C12H18NNaO8Sb and a molecular weight of 449.03 g/mol.
| Compound Name | CID 131884369 |
|---|---|
| PubChem CID | 131884369 |
| Molecular Formula | C12H18NNaO8Sb |
| Molecular Weight | 449.03 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | — |
| SMILES | O=[Sb](O)(O)c1ccc(N[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1.[Na] |
| InChI | InChI=1S/C12H16NO5.Na.2H2O.O.Sb/c14-6-8-9(15)10(16)11(17)12(18-8)13-7-4-2-1-3-5-7;;;;;/h2-5,8-17H,6H2;;2*1H2;;/q;;;;;+2/p-2/t8-,9-,10+,11-,12-;;;;;/m1...../s1 |
| InChIKey | XSMDTYGGKCMSNR-XKNCYHABSA-L |
| XLogP | -3.92 |
| TPSA | 159.71 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.03 |
| LogP ≤ 5 | -3.92 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|