C12H18N2O5 — CID 89146864
2-(4-aminoanilino)-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 89146864) has the molecular formula C12H18N2O5 and a molecular weight of 270.29 g/mol. Its IUPAC name is 2-(4-aminoanilino)-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-(4-aminoanilino)-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 89146864 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(4-aminoanilino)-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | Nc1ccc(NC2OC(CO)C(O)C(O)C2O)cc1 |
| InChI | InChI=1S/C12H18N2O5/c13-6-1-3-7(4-2-6)14-12-11(18)10(17)9(16)8(5-15)19-12/h1-4,8-12,14-18H,5,13H2 |
| InChIKey | DCXQCKBHXKJGKU-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 128.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|