C26H42ClNO3 — CID 131884662
N-[2-chloro-3-(2-hydroxy-3-methylphenyl)prop-2-enyl]-8-methoxy-N-methyltetradecanamide (PubChem CID 131884662) has the molecular formula C26H42ClNO3 and a molecular weight of 452.08 g/mol. Its IUPAC name is N-[2-chloro-3-(2-hydroxy-3-methylphenyl)prop-2-enyl]-8-methoxy-N-methyltetradecanamide.
| Compound Name | N-[2-chloro-3-(2-hydroxy-3-methylphenyl)prop-2-enyl]-8-methoxy-N-methyltetradecanamide |
|---|---|
| PubChem CID | 131884662 |
| Molecular Formula | C26H42ClNO3 |
| Molecular Weight | 452.08 g/mol |
| Exact Mass | 451.29 |
| IUPAC Name | N-[2-chloro-3-(2-hydroxy-3-methylphenyl)prop-2-enyl]-8-methoxy-N-methyltetradecanamide |
| SMILES | CCCCCCC(CCCCCCC(=O)N(C)CC(Cl)=Cc1cccc(C)c1O)OC |
| InChI | InChI=1S/C26H42ClNO3/c1-5-6-7-10-16-24(31-4)17-11-8-9-12-18-25(29)28(3)20-23(27)19-22-15-13-14-21(2)26(22)30/h13-15,19,24,30H,5-12,16-18,20H2,1-4H3 |
| InChIKey | UUYJRDPLTNURCV-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.08 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|