About 3-benzhydryloxyazetidine;hydrochloride
3-benzhydryloxyazetidine;hydrochloride (PubChem CID 131885172) has the molecular formula C16H18ClNO
and a molecular weight of 275.78 g/mol. Its IUPAC name is 3-benzhydryloxyazetidine;hydrochloride.
Molecular Properties
| Compound Name | 3-benzhydryloxyazetidine;hydrochloride |
| PubChem CID | 131885172 |
| Molecular Formula | C16H18ClNO |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 3-benzhydryloxyazetidine;hydrochloride |
| SMILES | Cl.c1ccc(C(OC2CNC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H17NO.ClH/c1-3-7-13(8-4-1)16(18-15-11-17-12-15)14-9-5-2-6-10-14;/h1-10,15-17H,11-12H2;1H |
| InChIKey | ZEZYSHRTNVKABV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-benzhydryloxyazetidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzhydryloxyazetidine;hydrochloride?
The IUPAC name of 3-benzhydryloxyazetidine;hydrochloride (CID 131885172) is 3-benzhydryloxyazetidine;hydrochloride.
What is the SMILES notation for 3-benzhydryloxyazetidine;hydrochloride?
The canonical SMILES for 3-benzhydryloxyazetidine;hydrochloride is Cl.c1ccc(C(OC2CNC2)c2ccccc2)cc1.
What is the InChIKey of 3-benzhydryloxyazetidine;hydrochloride?
The InChIKey is ZEZYSHRTNVKABV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO.ClH/c1-3-7-13(8-4-1)16(18-15-11-17-12-15)14-9-5-2-6-10-14;/h1-10,15-17H,11-12H2;1H.
What are the key properties of 3-benzhydryloxyazetidine;hydrochloride?
3-benzhydryloxyazetidine;hydrochloride has a molecular weight of 275.78 g/mol, XLogP of 3.19, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzhydryloxyazetidine;hydrochloride is sourced from PubChem (CID 131885172), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).