C7H14Cl2FN2O2P — CID 131885179
(2R,5R)-N,N-bis(2-chloroethyl)-5-fluoro-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine (PubChem CID 131885179) has the molecular formula C7H14Cl2FN2O2P and a molecular weight of 279.08 g/mol. Its IUPAC name is (2R,5R)-N,N-bis(2-chloroethyl)-5-fluoro-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine.
| Compound Name | (2R,5R)-N,N-bis(2-chloroethyl)-5-fluoro-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
|---|---|
| PubChem CID | 131885179 |
| Molecular Formula | C7H14Cl2FN2O2P |
| Molecular Weight | 279.08 g/mol |
| Exact Mass | 278.02 |
| IUPAC Name | (2R,5R)-N,N-bis(2-chloroethyl)-5-fluoro-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine |
| SMILES | O=[P@]1(N(CCCl)CCCl)NC[C@@H](F)CO1 |
| InChI | InChI=1S/C7H14Cl2FN2O2P/c8-1-3-12(4-2-9)15(13)11-5-7(10)6-14-15/h7H,1-6H2,(H,11,13)/t7-,15-/m1/s1 |
| InChIKey | PBDYZVRPUSRBCR-KWKYVRJSSA-N |
| XLogP | 1.83 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.08 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|