C12H25N — CID 131886244
2-methyl-N-(2,4,4-trimethylpentan-2-yl)propan-1-imine (PubChem CID 131886244) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 2-methyl-N-(2,4,4-trimethylpentan-2-yl)propan-1-imine.
| Compound Name | 2-methyl-N-(2,4,4-trimethylpentan-2-yl)propan-1-imine |
|---|---|
| PubChem CID | 131886244 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 2-methyl-N-(2,4,4-trimethylpentan-2-yl)propan-1-imine |
| SMILES | CC(C)/C=N/C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C12H25N/c1-10(2)8-13-12(6,7)9-11(3,4)5/h8,10H,9H2,1-7H3/b13-8+ |
| InChIKey | LATRNXTYRJETCO-MDWZMJQESA-N |
| XLogP | 3.93 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|