C11H23N3 — CID 163299551
N-[(1Z)-1-hydrazinylidene-2,3-dimethylpentan-2-yl]-2-methylpropan-1-imine (PubChem CID 163299551) has the molecular formula C11H23N3 and a molecular weight of 197.33 g/mol. Its IUPAC name is N-[(1Z)-1-hydrazinylidene-2,3-dimethylpentan-2-yl]-2-methylpropan-1-imine.
| Compound Name | N-[(1Z)-1-hydrazinylidene-2,3-dimethylpentan-2-yl]-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 163299551 |
| Molecular Formula | C11H23N3 |
| Molecular Weight | 197.33 g/mol |
| Exact Mass | 197.19 |
| IUPAC Name | N-[(1Z)-1-hydrazinylidene-2,3-dimethylpentan-2-yl]-2-methylpropan-1-imine |
| SMILES | CCC(C)C(C)(/C=N\N)/N=C/C(C)C |
| InChI | InChI=1S/C11H23N3/c1-6-10(4)11(5,8-14-12)13-7-9(2)3/h7-10H,6,12H2,1-5H3/b13-7+,14-8- |
| InChIKey | ZYWWKTSNKJJVBN-GUZOQHLSSA-N |
| XLogP | 2.46 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|