C8H17Cl3NNb — CID 87500633
trichloro(2,4,4-trimethylpentan-2-ylimino)niobium (PubChem CID 87500633) has the molecular formula C8H17Cl3NNb and a molecular weight of 326.50 g/mol. Its IUPAC name is trichloro(2,4,4-trimethylpentan-2-ylimino)niobium.
| Compound Name | trichloro(2,4,4-trimethylpentan-2-ylimino)niobium |
|---|---|
| PubChem CID | 87500633 |
| Molecular Formula | C8H17Cl3NNb |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | trichloro(2,4,4-trimethylpentan-2-ylimino)niobium |
| SMILES | CC(C)(C)CC(C)(C)N=[Nb](Cl)(Cl)Cl |
| InChI | InChI=1S/C8H17N.3ClH.Nb/c1-7(2,3)6-8(4,5)9;;;;/h6H2,1-5H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | LUXXCXIKGVBJTC-UHFFFAOYSA-K |
| XLogP | 5.00 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |