C24H50 — CID 158947018
2,2,4,4,6,6,7,7,9,9,11,11-dodecamethyldodecane (PubChem CID 158947018) has the molecular formula C24H50 and a molecular weight of 338.66 g/mol. Its IUPAC name is 2,2,4,4,6,6,7,7,9,9,11,11-dodecamethyldodecane.
| Compound Name | 2,2,4,4,6,6,7,7,9,9,11,11-dodecamethyldodecane |
|---|---|
| PubChem CID | 158947018 |
| Molecular Formula | C24H50 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 338.39 |
| IUPAC Name | 2,2,4,4,6,6,7,7,9,9,11,11-dodecamethyldodecane |
| SMILES | CC(C)(C)CC(C)(C)CC(C)(C)C(C)(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C24H50/c1-19(2,3)15-21(7,8)17-23(11,12)24(13,14)18-22(9,10)16-20(4,5)6/h15-18H2,1-14H3 |
| InChIKey | JKYIRBILVZBRHO-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |