C16H36Si — CID 150942807
2,4,4,6,6,8,8-heptamethylnonylsilane (PubChem CID 150942807) has the molecular formula C16H36Si and a molecular weight of 256.55 g/mol. Its IUPAC name is 2,4,4,6,6,8,8-heptamethylnonylsilane.
| Compound Name | 2,4,4,6,6,8,8-heptamethylnonylsilane |
|---|---|
| PubChem CID | 150942807 |
| Molecular Formula | C16H36Si |
| Molecular Weight | 256.55 g/mol |
| Exact Mass | 256.26 |
| IUPAC Name | 2,4,4,6,6,8,8-heptamethylnonylsilane |
| SMILES | CC(C[SiH3])CC(C)(C)CC(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H36Si/c1-13(10-17)9-15(5,6)12-16(7,8)11-14(2,3)4/h13H,9-12H2,1-8,17H3 |
| InChIKey | LIKHMMPVTGBWPX-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.55 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|